C24H44Si2 — CID 123378194
trimethyl-(12-trimethylsilyl-4-pentacyclo[8.6.1.12,5.013,17.09,18]octadecanyl)silane (PubChem CID 123378194) has the molecular formula C24H44Si2 and a molecular weight of 388.79 g/mol. Its IUPAC name is trimethyl-(12-trimethylsilyl-4-pentacyclo[8.6.1.12,5.013,17.09,18]octadecanyl)silane.
| Compound Name | trimethyl-(12-trimethylsilyl-4-pentacyclo[8.6.1.12,5.013,17.09,18]octadecanyl)silane |
|---|---|
| PubChem CID | 123378194 |
| Molecular Formula | C24H44Si2 |
| Molecular Weight | 388.79 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | trimethyl-(12-trimethylsilyl-4-pentacyclo[8.6.1.12,5.013,17.09,18]octadecanyl)silane |
| SMILES | C[Si](C)(C)C1CC2C3CCCC4C3C(CC4[Si](C)(C)C)C3CCCC1C32 |
| InChI | InChI=1S/C24H44Si2/c1-25(2,3)21-13-19-15-10-8-12-18-22(26(4,5)6)14-20(24(15)18)16-9-7-11-17(21)23(16)19/h15-24H,7-14H2,1-6H3 |
| InChIKey | KJIKFXGOWUBNTK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.79 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|