C19H21BrN3O4+ — CID 123378282
6-(5-bromo-1,3-benzodioxol-4-yl)-2,3,5,7-tetramethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-5-ium-7-carbonitrile (PubChem CID 123378282) has the molecular formula C19H21BrN3O4+ and a molecular weight of 435.30 g/mol. Its IUPAC name is 6-(5-bromo-1,3-benzodioxol-4-yl)-2,3,5,7-tetramethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-5-ium-7-carbonitrile.
| Compound Name | 6-(5-bromo-1,3-benzodioxol-4-yl)-2,3,5,7-tetramethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-5-ium-7-carbonitrile |
|---|---|
| PubChem CID | 123378282 |
| Molecular Formula | C19H21BrN3O4+ |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 6-(5-bromo-1,3-benzodioxol-4-yl)-2,3,5,7-tetramethyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazin-5-ium-7-carbonitrile |
| SMILES | CC1C(=O)[N+]2(C)C(CC(C)(C#N)C2c2c(Br)ccc3c2OCO3)C(=O)N1C |
| InChI | InChI=1S/C19H21BrN3O4/c1-10-18(25)23(4)12(17(24)22(10)3)7-19(2,8-21)16(23)14-11(20)5-6-13-15(14)27-9-26-13/h5-6,10,12,16H,7,9H2,1-4H3/q+1 |
| InChIKey | BODQTQSPJQIGDB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|