About 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene
2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene (PubChem CID 123378423) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene |
| PubChem CID | 123378423 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene |
| SMILES | C=C(C)C(=CC(=C)C1=C(C)C=CCC1)CCC |
| InChI | InChI=1S/C17H24/c1-6-9-16(13(2)3)12-15(5)17-11-8-7-10-14(17)4/h7,10,12H,2,5-6,8-9,11H2,1,3-4H3 |
| InChIKey | YPQSMGXDJKNLEC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene?
The IUPAC name of 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene (CID 123378423) is 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene.
What is the SMILES notation for 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene?
The canonical SMILES for 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene is C=C(C)C(=CC(=C)C1=C(C)C=CCC1)CCC.
What is the InChIKey of 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene?
The InChIKey is YPQSMGXDJKNLEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24/c1-6-9-16(13(2)3)12-15(5)17-11-8-7-10-14(17)4/h7,10,12H,2,5-6,8-9,11H2,1,3-4H3.
What are the key properties of 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene?
2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene has a molecular weight of 228.38 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(4-prop-1-en-2-ylhepta-1,3-dien-2-yl)cyclohexa-1,3-diene is sourced from PubChem (CID 123378423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).