About 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine
2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine (PubChem CID 123378587) has the molecular formula C9H9F2N3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine |
| PubChem CID | 123378587 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine |
| SMILES | Cc1ccc2nc(C(F)F)c(C)n2n1 |
| InChI | InChI=1S/C9H9F2N3/c1-5-3-4-7-12-8(9(10)11)6(2)14(7)13-5/h3-4,9H,1-2H3 |
| InChIKey | KVQOEZRAFAXQOG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine?
The IUPAC name of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine (CID 123378587) is 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine?
The canonical SMILES for 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine is Cc1ccc2nc(C(F)F)c(C)n2n1.
What is the InChIKey of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine?
The InChIKey is KVQOEZRAFAXQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N3/c1-5-3-4-7-12-8(9(10)11)6(2)14(7)13-5/h3-4,9H,1-2H3.
What are the key properties of 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine?
2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine has a molecular weight of 197.19 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-3,6-dimethylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 123378587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).