C29H39F3N4O4Si — CID 123378933
tert-butyl 2,2-dimethyl-3-[[5-[4-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate (PubChem CID 123378933) has the molecular formula C29H39F3N4O4Si and a molecular weight of 592.74 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3-[[5-[4-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate.
| Compound Name | tert-butyl 2,2-dimethyl-3-[[5-[4-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123378933 |
| Molecular Formula | C29H39F3N4O4Si |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | tert-butyl 2,2-dimethyl-3-[[5-[4-[5-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(C(F)(F)F)nn3COCC[Si](C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C29H39F3N4O4Si/c1-27(2,3)40-26(37)28(4,5)18-39-23-14-13-22(17-33-23)20-9-11-21(12-10-20)24-34-25(29(30,31)32)35-36(24)19-38-15-16-41(6,7)8/h9-14,17H,15-16,18-19H2,1-8H3 |
| InChIKey | IJAPNFXCHFVNBB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|