About amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol
amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol (PubChem CID 123379092) has the molecular formula C14H17Cl2N3O
and a molecular weight of 314.22 g/mol. Its IUPAC name is amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol |
| PubChem CID | 123379092 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol |
| SMILES | C=C(CCc1nc(Cl)ncc1Cl)C(=C)C1(C(N)O)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-8(9(2)14(5-6-14)12(17)20)3-4-11-10(15)7-18-13(16)19-11/h7,12,20H,1-6,17H2 |
| InChIKey | QMLFTZMYJALNCP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol?
The IUPAC name of amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol (CID 123379092) is amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol.
What is the SMILES notation for amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol?
The canonical SMILES for amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol is C=C(CCc1nc(Cl)ncc1Cl)C(=C)C1(C(N)O)CC1.
What is the InChIKey of amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol?
The InChIKey is QMLFTZMYJALNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3O/c1-8(9(2)14(5-6-14)12(17)20)3-4-11-10(15)7-18-13(16)19-11/h7,12,20H,1-6,17H2.
What are the key properties of amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol?
amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol has a molecular weight of 314.22 g/mol, XLogP of 2.89, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[1-[5-(2,5-dichloropyrimidin-4-yl)-3-methylidenepent-1-en-2-yl]cyclopropyl]methanol is sourced from PubChem (CID 123379092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).