C15H21N — CID 123379230
(4Z)-N-[(2E,4E)-octa-2,4,6-trien-4-yl]hepta-1,4-dien-3-imine (PubChem CID 123379230) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (4Z)-N-[(2E,4E)-octa-2,4,6-trien-4-yl]hepta-1,4-dien-3-imine.
| Compound Name | (4Z)-N-[(2E,4E)-octa-2,4,6-trien-4-yl]hepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123379230 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (4Z)-N-[(2E,4E)-octa-2,4,6-trien-4-yl]hepta-1,4-dien-3-imine |
| SMILES | C=CC(/C=C\CC)=N\C(\C=C\C)=C\C=CC |
| InChI | InChI=1S/C15H21N/c1-5-9-12-14(8-4)16-15(11-7-3)13-10-6-2/h6-13H,4-5H2,1-3H3/b10-6?,11-7+,12-9-,15-13+,16-14+ |
| InChIKey | ZZEBZGDJEAXPPM-XBJOLQDISA-N |
| XLogP | 4.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|