C11H14N4O — CID 123379391
2-amino-8-ethyl-4,6-dimethylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 123379391) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-amino-8-ethyl-4,6-dimethylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-8-ethyl-4,6-dimethylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 123379391 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-amino-8-ethyl-4,6-dimethylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(C)cc2c(C)nc(N)nc21 |
| InChI | InChI=1S/C11H14N4O/c1-4-15-9-8(5-6(2)10(15)16)7(3)13-11(12)14-9/h5H,4H2,1-3H3,(H2,12,13,14) |
| InChIKey | UHTQZACEMXXNQW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |