C5H5N3O3S — CID 123379520
(1,3-thiazole-5-carbonylamino)carbamic acid (PubChem CID 123379520) has the molecular formula C5H5N3O3S and a molecular weight of 187.18 g/mol. Its IUPAC name is (1,3-thiazole-5-carbonylamino)carbamic acid.
| Compound Name | (1,3-thiazole-5-carbonylamino)carbamic acid |
|---|---|
| PubChem CID | 123379520 |
| Molecular Formula | C5H5N3O3S |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | (1,3-thiazole-5-carbonylamino)carbamic acid |
| SMILES | O=C(O)NNC(=O)c1cncs1 |
| InChI | InChI=1S/C5H5N3O3S/c9-4(7-8-5(10)11)3-1-6-2-12-3/h1-2,8H,(H,7,9)(H,10,11) |
| InChIKey | DLXQULZAGYSLLP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|