About 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one
1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one (PubChem CID 123380283) has the molecular formula C8H13BO3
and a molecular weight of 168.00 g/mol. Its IUPAC name is 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one.
Molecular Properties
| Compound Name | 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one |
| PubChem CID | 123380283 |
| Molecular Formula | C8H13BO3 |
| Molecular Weight | 168.00 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one |
| SMILES | CCC(=O)CC1C=CCB(O)O1 |
| InChI | InChI=1S/C8H13BO3/c1-2-7(10)6-8-4-3-5-9(11)12-8/h3-4,8,11H,2,5-6H2,1H3 |
| InChIKey | AGDATYNMCWCXFR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.00 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one?
The IUPAC name of 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one (CID 123380283) is 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one.
What is the SMILES notation for 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one?
The canonical SMILES for 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one is CCC(=O)CC1C=CCB(O)O1.
What is the InChIKey of 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one?
The InChIKey is AGDATYNMCWCXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BO3/c1-2-7(10)6-8-4-3-5-9(11)12-8/h3-4,8,11H,2,5-6H2,1H3.
What are the key properties of 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one?
1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one has a molecular weight of 168.00 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-3,6-dihydrooxaborinin-6-yl)butan-2-one is sourced from PubChem (CID 123380283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).