C8H10N3O+ — CID 123380462
6,7-dimethyl-[1,2]oxazolo[5,4-c]pyridin-6-ium-3-amine (PubChem CID 123380462) has the molecular formula C8H10N3O+ and a molecular weight of 164.19 g/mol. Its IUPAC name is 6,7-dimethyl-[1,2]oxazolo[5,4-c]pyridin-6-ium-3-amine.
| Compound Name | 6,7-dimethyl-[1,2]oxazolo[5,4-c]pyridin-6-ium-3-amine |
|---|---|
| PubChem CID | 123380462 |
| Molecular Formula | C8H10N3O+ |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 6,7-dimethyl-[1,2]oxazolo[5,4-c]pyridin-6-ium-3-amine |
| SMILES | Cc1c2onc(N)c2cc[n+]1C |
| InChI | InChI=1S/C8H10N3O/c1-5-7-6(3-4-11(5)2)8(9)10-12-7/h3-4H,1-2H3,(H2,9,10)/q+1 |
| InChIKey | GOWHSAGZLAVJBV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|