About N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine
N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine (PubChem CID 123380853) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine.
Molecular Properties
| Compound Name | N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine |
| PubChem CID | 123380853 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine |
| SMILES | C=C(C(C)=CC=CC)N(C)CN |
| InChI | InChI=1S/C10H18N2/c1-5-6-7-9(2)10(3)12(4)8-11/h5-7H,3,8,11H2,1-2,4H3 |
| InChIKey | OZHAHGDTERPMFP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine?
The IUPAC name of N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine (CID 123380853) is N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine.
What is the SMILES notation for N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine?
The canonical SMILES for N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine is C=C(C(C)=CC=CC)N(C)CN.
What is the InChIKey of N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine?
The InChIKey is OZHAHGDTERPMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-6-7-9(2)10(3)12(4)8-11/h5-7H,3,8,11H2,1-2,4H3.
What are the key properties of N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine?
N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine has a molecular weight of 166.27 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(3-methylhepta-1,3,5-trien-2-yl)methanediamine is sourced from PubChem (CID 123380853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).