C28H25F2N3O2 — CID 123380879
7-[4-(1,1-difluoropent-3-enyl)phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 123380879) has the molecular formula C28H25F2N3O2 and a molecular weight of 473.52 g/mol. Its IUPAC name is 7-[4-(1,1-difluoropent-3-enyl)phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 7-[4-(1,1-difluoropent-3-enyl)phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 123380879 |
| Molecular Formula | C28H25F2N3O2 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 7-[4-(1,1-difluoropent-3-enyl)phenyl]-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CC=CCC(F)(F)c1ccc(-c2ccc3c(c2)C(=O)N(Cc2cn4ccccc4n2)CCO3)cc1 |
| InChI | InChI=1S/C28H25F2N3O2/c1-2-3-13-28(29,30)22-10-7-20(8-11-22)21-9-12-25-24(17-21)27(34)33(15-16-35-25)19-23-18-32-14-5-4-6-26(32)31-23/h2-12,14,17-18H,13,15-16,19H2,1H3 |
| InChIKey | YKSWAEBHDADWHZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|