C18H29N5 — CID 123381141
4-N-butyl-6-(2-ethylidenepent-3-enyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine (PubChem CID 123381141) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is 4-N-butyl-6-(2-ethylidenepent-3-enyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-(2-ethylidenepent-3-enyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123381141 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 4-N-butyl-6-(2-ethylidenepent-3-enyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-2,4-diamine |
| SMILES | CC=CC(=CC)CN1CCc2nc(N)nc(NCCCC)c2C1 |
| InChI | InChI=1S/C18H29N5/c1-4-7-10-20-17-15-13-23(12-14(6-3)8-5-2)11-9-16(15)21-18(19)22-17/h5-6,8H,4,7,9-13H2,1-3H3,(H3,19,20,21,22) |
| InChIKey | GKVXOMMOKOKVIJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|