C18H32N+ — CID 123381207
butan-2-ylidene-(3-but-1-enylnona-1,6-dien-2-yl)-methylazanium (PubChem CID 123381207) has the molecular formula C18H32N+ and a molecular weight of 262.46 g/mol. Its IUPAC name is butan-2-ylidene-(3-but-1-enylnona-1,6-dien-2-yl)-methylazanium.
| Compound Name | butan-2-ylidene-(3-but-1-enylnona-1,6-dien-2-yl)-methylazanium |
|---|---|
| PubChem CID | 123381207 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | butan-2-ylidene-(3-but-1-enylnona-1,6-dien-2-yl)-methylazanium |
| SMILES | C=C(C(C=CCC)CCC=CCC)/[N+](C)=C(\C)CC |
| InChI | InChI=1S/C18H32N/c1-7-10-12-13-15-18(14-11-8-2)17(5)19(6)16(4)9-3/h10-12,14,18H,5,7-9,13,15H2,1-4,6H3/q+1/b12-10?,14-11?,19-16+ |
| InChIKey | FYXIWJGSZPGEII-SBYYWVJISA-N |
| XLogP | 5.34 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|