C18H33BN2O4 — CID 123381234
3,3-dimethylpentyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate (PubChem CID 123381234) has the molecular formula C18H33BN2O4 and a molecular weight of 352.28 g/mol. Its IUPAC name is 3,3-dimethylpentyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate.
| Compound Name | 3,3-dimethylpentyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 123381234 |
| Molecular Formula | C18H33BN2O4 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 3,3-dimethylpentyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole-5-carboxylate |
| SMILES | CCC(C)(C)CCOC(=O)C1C=C(B2OC(C)(C)C(C)(C)O2)N(C)N1 |
| InChI | InChI=1S/C18H33BN2O4/c1-9-16(2,3)10-11-23-15(22)13-12-14(21(8)20-13)19-24-17(4,5)18(6,7)25-19/h12-13,20H,9-11H2,1-8H3 |
| InChIKey | ITHYXMINVFZDTN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|