C30H25BF2N2O3 — CID 123381238
3-[2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione (PubChem CID 123381238) has the molecular formula C30H25BF2N2O3 and a molecular weight of 510.35 g/mol. Its IUPAC name is 3-[2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione.
| Compound Name | 3-[2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione |
|---|---|
| PubChem CID | 123381238 |
| Molecular Formula | C30H25BF2N2O3 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-[2-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione |
| SMILES | CC1=CC(C)=[N+]2C1=C(C=Cc1cc3cc4c(cc3oc1=O)C#CCCC(=O)C4)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C30H25BF2N2O3/c1-17-11-19(3)34-28(17)26(29-18(2)12-20(4)35(29)31(34,32)33)10-9-22-13-24-14-23-15-25(36)8-6-5-7-21(23)16-27(24)38-30(22)37/h9-14,16H,6,8,15H2,1-4H3 |
| InChIKey | FWRVXSUPHQVLRB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|