C23H26F5N5O — CID 123381405
N-[N-[amino-[2-(propylamino)-5-(trifluoromethyl)phenyl]methylidene]-N'-tert-butylcarbamimidoyl]-3,4-difluorobenzamide (PubChem CID 123381405) has the molecular formula C23H26F5N5O and a molecular weight of 483.49 g/mol. Its IUPAC name is N-[N-[amino-[2-(propylamino)-5-(trifluoromethyl)phenyl]methylidene]-N'-tert-butylcarbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-[amino-[2-(propylamino)-5-(trifluoromethyl)phenyl]methylidene]-N'-tert-butylcarbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 123381405 |
| Molecular Formula | C23H26F5N5O |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[N-[amino-[2-(propylamino)-5-(trifluoromethyl)phenyl]methylidene]-N'-tert-butylcarbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCCNc1ccc(C(F)(F)F)cc1C(N)=N/C(=N/C(C)(C)C)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H26F5N5O/c1-5-10-30-18-9-7-14(23(26,27)28)12-15(18)19(29)31-21(33-22(2,3)4)32-20(34)13-6-8-16(24)17(25)11-13/h6-9,11-12,30H,5,10H2,1-4H3,(H3,29,31,32,33,34) |
| InChIKey | KWSZCEJPFXIKQR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|