About 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one
4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one (PubChem CID 123381766) has the molecular formula C8H12F3NO
and a molecular weight of 195.18 g/mol. Its IUPAC name is 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one.
Molecular Properties
| Compound Name | 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one |
| PubChem CID | 123381766 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one |
| SMILES | CC(=O)C(/N=C/C(F)(F)F)C(C)C |
| InChI | InChI=1S/C8H12F3NO/c1-5(2)7(6(3)13)12-4-8(9,10)11/h4-5,7H,1-3H3/b12-4+ |
| InChIKey | RKYUAINSOJRXMN-UUILKARUSA-N |
| XLogP | 2.23 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one?
The IUPAC name of 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one (CID 123381766) is 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one.
What is the SMILES notation for 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one?
The canonical SMILES for 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one is CC(=O)C(/N=C/C(F)(F)F)C(C)C.
What is the InChIKey of 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one?
The InChIKey is RKYUAINSOJRXMN-UUILKARUSA-N. The full InChI is InChI=1S/C8H12F3NO/c1-5(2)7(6(3)13)12-4-8(9,10)11/h4-5,7H,1-3H3/b12-4+.
What are the key properties of 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one?
4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one has a molecular weight of 195.18 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(2,2,2-trifluoroethylideneamino)pentan-2-one is sourced from PubChem (CID 123381766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).