C24H31NO4 — CID 123381922
5-(cyclopropylmethyl)-16-(hydroxymethyl)-11-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-15-ol (PubChem CID 123381922) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-16-(hydroxymethyl)-11-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-15-ol.
| Compound Name | 5-(cyclopropylmethyl)-16-(hydroxymethyl)-11-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-15-ol |
|---|---|
| PubChem CID | 123381922 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 5-(cyclopropylmethyl)-16-(hydroxymethyl)-11-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-15-ol |
| SMILES | COc1ccc2c3c1OC1C4(O)CCC5(CC4CO)C(C2)N(CC2CC2)CCC315 |
| InChI | InChI=1S/C24H31NO4/c1-28-17-5-4-15-10-18-22-6-7-24(27,16(11-22)13-26)21-23(22,19(15)20(17)29-21)8-9-25(18)12-14-2-3-14/h4-5,14,16,18,21,26-27H,2-3,6-13H2,1H3 |
| InChIKey | UFJNRTCPFJYSEK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |