C14H15N5 — CID 123382339
1-phenyl-2-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)ethane-1,2-diimine (PubChem CID 123382339) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-phenyl-2-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)ethane-1,2-diimine.
| Compound Name | 1-phenyl-2-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 123382339 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-phenyl-2-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)ethane-1,2-diimine |
| SMILES | [H]/N=C(C(=N/[H])/c1ccccc1)\N1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C14H15N5/c15-13(10-4-2-1-3-5-10)14(16)19-7-6-11-8-17-18-12(11)9-19/h1-5,8,15-16H,6-7,9H2,(H,17,18)/b15-13+,16-14- |
| InChIKey | BHEOIACVIQJDRO-ZNOBWPMYSA-N |
| XLogP | 1.81 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|