C27H20N2O4S2 — CID 123382436
1-[2-[2-[3-(phenylmethoxymethylamino)furo[2,3-c]pyridin-2-yl]ethynyl]thieno[3,2-b]thiophen-5-yl]cyclopropane-1-carboxylic acid (PubChem CID 123382436) has the molecular formula C27H20N2O4S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-[2-[2-[3-(phenylmethoxymethylamino)furo[2,3-c]pyridin-2-yl]ethynyl]thieno[3,2-b]thiophen-5-yl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[2-[2-[3-(phenylmethoxymethylamino)furo[2,3-c]pyridin-2-yl]ethynyl]thieno[3,2-b]thiophen-5-yl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 123382436 |
| Molecular Formula | C27H20N2O4S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 1-[2-[2-[3-(phenylmethoxymethylamino)furo[2,3-c]pyridin-2-yl]ethynyl]thieno[3,2-b]thiophen-5-yl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc3sc(C#Cc4oc5cnccc5c4NCOCc4ccccc4)cc3s2)CC1 |
| InChI | InChI=1S/C27H20N2O4S2/c30-26(31)27(9-10-27)24-13-23-22(35-24)12-18(34-23)6-7-20-25(19-8-11-28-14-21(19)33-20)29-16-32-15-17-4-2-1-3-5-17/h1-5,8,11-14,29H,9-10,15-16H2,(H,30,31) |
| InChIKey | OJILJUGMEZWROZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|