C23H21ClIN3O4S2 — CID 123382559
5-[5-chloro-2-iodo-6-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazole (PubChem CID 123382559) has the molecular formula C23H21ClIN3O4S2 and a molecular weight of 629.93 g/mol. Its IUPAC name is 5-[5-chloro-2-iodo-6-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazole.
| Compound Name | 5-[5-chloro-2-iodo-6-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazole |
|---|---|
| PubChem CID | 123382559 |
| Molecular Formula | C23H21ClIN3O4S2 |
| Molecular Weight | 629.93 g/mol |
| Exact Mass | 628.97 |
| IUPAC Name | 5-[5-chloro-2-iodo-6-(4-methylphenyl)sulfonyl-1H-pyrrolo[2,3-b]pyridin-4-yl]-2-[1-(methoxymethoxy)cyclobutyl]-1,3-thiazole |
| SMILES | COCOC1(c2ncc(-c3c(Cl)c(S(=O)(=O)c4ccc(C)cc4)nc4[nH]c(I)cc34)s2)CCC1 |
| InChI | InChI=1S/C23H21ClIN3O4S2/c1-13-4-6-14(7-5-13)34(29,30)21-19(24)18(15-10-17(25)27-20(15)28-21)16-11-26-22(33-16)23(8-3-9-23)32-12-31-2/h4-7,10-11H,3,8-9,12H2,1-2H3,(H,27,28) |
| InChIKey | FOILLIMIADRXKU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.93 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|