About 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone
1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone (PubChem CID 123382583) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone |
| PubChem CID | 123382583 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone |
| SMILES | C=CC=CC1CCCC(C(C)=O)N1 |
| InChI | InChI=1S/C11H17NO/c1-3-4-6-10-7-5-8-11(12-10)9(2)13/h3-4,6,10-12H,1,5,7-8H2,2H3 |
| InChIKey | CWOAQOBXUCIEKL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone?
The IUPAC name of 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone (CID 123382583) is 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone.
What is the SMILES notation for 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone?
The canonical SMILES for 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone is C=CC=CC1CCCC(C(C)=O)N1.
What is the InChIKey of 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone?
The InChIKey is CWOAQOBXUCIEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-3-4-6-10-7-5-8-11(12-10)9(2)13/h3-4,6,10-12H,1,5,7-8H2,2H3.
What are the key properties of 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone?
1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone has a molecular weight of 179.26 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-buta-1,3-dienylpiperidin-2-yl)ethanone is sourced from PubChem (CID 123382583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).