About 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine
7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine (PubChem CID 123382807) has the molecular formula C11H18FN
and a molecular weight of 183.27 g/mol. Its IUPAC name is 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine.
Molecular Properties
| Compound Name | 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine |
| PubChem CID | 123382807 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine |
| SMILES | C=C(F)C=CC(=C)C(C)CCNC |
| InChI | InChI=1S/C11H18FN/c1-9(5-6-11(3)12)10(2)7-8-13-4/h5-6,10,13H,1,3,7-8H2,2,4H3 |
| InChIKey | BTXNGYMRTDBMFC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine?
The IUPAC name of 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine (CID 123382807) is 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine.
What is the SMILES notation for 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine?
The canonical SMILES for 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine is C=C(F)C=CC(=C)C(C)CCNC.
What is the InChIKey of 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine?
The InChIKey is BTXNGYMRTDBMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18FN/c1-9(5-6-11(3)12)10(2)7-8-13-4/h5-6,10,13H,1,3,7-8H2,2,4H3.
What are the key properties of 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine?
7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine has a molecular weight of 183.27 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N,3-dimethyl-4-methylideneocta-5,7-dien-1-amine is sourced from PubChem (CID 123382807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).