About 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one
3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 123383133) has the molecular formula C7H9ClN2O
and a molecular weight of 172.61 g/mol. Its IUPAC name is 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one |
| PubChem CID | 123383133 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C)c(NCl)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9ClN2O/c1-4-3-5(2)9-7(11)6(4)10-8/h3,10H,1-2H3,(H,9,11) |
| InChIKey | DUKGPJLGFJQELH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one?
The IUPAC name of 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one (CID 123383133) is 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one.
What is the SMILES notation for 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one?
The canonical SMILES for 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one is Cc1cc(C)c(NCl)c(=O)[nH]1.
What is the InChIKey of 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one?
The InChIKey is DUKGPJLGFJQELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O/c1-4-3-5(2)9-7(11)6(4)10-8/h3,10H,1-2H3,(H,9,11).
What are the key properties of 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one?
3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one has a molecular weight of 172.61 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloroamino)-4,6-dimethyl-1H-pyridin-2-one is sourced from PubChem (CID 123383133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).