C18H17F6N3O3S — CID 123383705
1-phenyl-4-[sulfino-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamoylamino]amino]benzene (PubChem CID 123383705) has the molecular formula C18H17F6N3O3S and a molecular weight of 469.41 g/mol. Its IUPAC name is 1-phenyl-4-[sulfino-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamoylamino]amino]benzene.
| Compound Name | 1-phenyl-4-[sulfino-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamoylamino]amino]benzene |
|---|---|
| PubChem CID | 123383705 |
| Molecular Formula | C18H17F6N3O3S |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 1-phenyl-4-[sulfino-[[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]carbamoylamino]amino]benzene |
| SMILES | CCC(NC(=O)NN(c1ccc(-c2ccccc2)cc1)S(=O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H17F6N3O3S/c1-2-16(17(19,20)21,18(22,23)24)25-15(28)26-27(31(29)30)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-11H,2H2,1H3,(H,29,30)(H2,25,26,28) |
| InChIKey | PNOMLELRTDAJDY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|