C7H7BrN2S — CID 123383852
1-(5-bromothiophen-2-yl)propane-1,3-diimine (PubChem CID 123383852) has the molecular formula C7H7BrN2S and a molecular weight of 231.12 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)propane-1,3-diimine.
| Compound Name | 1-(5-bromothiophen-2-yl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123383852 |
| Molecular Formula | C7H7BrN2S |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)propane-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\[H])c1ccc(Br)s1 |
| InChI | InChI=1S/C7H7BrN2S/c8-7-2-1-6(11-7)5(10)3-4-9/h1-2,4,9-10H,3H2/b9-4+,10-5+ |
| InChIKey | AOHDLNDMRZLGCY-LUZURFALSA-N |
| XLogP | 2.92 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|