About (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine
(Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine (PubChem CID 123384437) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine |
| PubChem CID | 123384437 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine |
| SMILES | C=C(/C=C\C)/N=C(C)/C=C\C |
| InChI | InChI=1S/C10H15N/c1-5-7-9(3)11-10(4)8-6-2/h5-8H,3H2,1-2,4H3/b7-5-,8-6-,11-10+ |
| InChIKey | LCDCSROTQLKPNM-QKOVNMMJSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine?
The IUPAC name of (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine (CID 123384437) is (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine.
What is the SMILES notation for (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine?
The canonical SMILES for (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine is C=C(/C=C\C)/N=C(C)/C=C\C.
What is the InChIKey of (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine?
The InChIKey is LCDCSROTQLKPNM-QKOVNMMJSA-N. The full InChI is InChI=1S/C10H15N/c1-5-7-9(3)11-10(4)8-6-2/h5-8H,3H2,1-2,4H3/b7-5-,8-6-,11-10+.
What are the key properties of (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine?
(Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine has a molecular weight of 149.24 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(3Z)-penta-1,3-dien-2-yl]pent-3-en-2-imine is sourced from PubChem (CID 123384437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).