About 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide
7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide (PubChem CID 123384503) has the molecular formula C6H8OS
and a molecular weight of 128.20 g/mol. Its IUPAC name is 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide.
Molecular Properties
| Compound Name | 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide |
| PubChem CID | 123384503 |
| Molecular Formula | C6H8OS |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide |
| SMILES | O=S1C2=CCC1CC2 |
| InChI | InChI=1S/C6H8OS/c7-8-5-1-2-6(8)4-3-5/h1,6H,2-4H2 |
| InChIKey | GNSJDCUMYHMZKW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide?
The IUPAC name of 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide (CID 123384503) is 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide.
What is the SMILES notation for 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide?
The canonical SMILES for 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide is O=S1C2=CCC1CC2.
What is the InChIKey of 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide?
The InChIKey is GNSJDCUMYHMZKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS/c7-8-5-1-2-6(8)4-3-5/h1,6H,2-4H2.
What are the key properties of 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide?
7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide has a molecular weight of 128.20 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7λ4-thiabicyclo[2.2.1]hept-1-ene 7-oxide is sourced from PubChem (CID 123384503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).