About 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate
2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate (PubChem CID 123384534) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate.
Molecular Properties
| Compound Name | 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate |
| PubChem CID | 123384534 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate |
| SMILES | CC=CC(=CC)COC(=O)C(=CC(C)C)CC(=O)NCC |
| InChI | InChI=1S/C17H27NO3/c1-6-9-14(7-2)12-21-17(20)15(10-13(4)5)11-16(19)18-8-3/h6-7,9-10,13H,8,11-12H2,1-5H3,(H,18,19) |
| InChIKey | LIAQMOBPGPWRSF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate?
The IUPAC name of 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate (CID 123384534) is 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate.
What is the SMILES notation for 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate?
The canonical SMILES for 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate is CC=CC(=CC)COC(=O)C(=CC(C)C)CC(=O)NCC.
What is the InChIKey of 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate?
The InChIKey is LIAQMOBPGPWRSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3/c1-6-9-14(7-2)12-21-17(20)15(10-13(4)5)11-16(19)18-8-3/h6-7,9-10,13H,8,11-12H2,1-5H3,(H,18,19).
What are the key properties of 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate?
2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate has a molecular weight of 293.41 g/mol, XLogP of 3.16, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidenepent-3-enyl 2-[2-(ethylamino)-2-oxoethyl]-4-methylpent-2-enoate is sourced from PubChem (CID 123384534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).