About 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane
5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane (PubChem CID 123384884) has the molecular formula C24H44O2S
and a molecular weight of 396.68 g/mol. Its IUPAC name is 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane.
Molecular Properties
| Compound Name | 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane |
| PubChem CID | 123384884 |
| Molecular Formula | C24H44O2S |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane |
| SMILES | CC=CC(=CC(=CC)OC(CCCC)CCCC)OC(CCC)CCSC |
| InChI | InChI=1S/C24H44O2S/c1-7-12-16-23(17-13-8-2)25-21(11-5)20-24(15-10-4)26-22(14-9-3)18-19-27-6/h10-11,15,20,22-23H,7-9,12-14,16-19H2,1-6H3 |
| InChIKey | HXLQWRVSWDKGRC-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane?
The IUPAC name of 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane (CID 123384884) is 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane.
What is the SMILES notation for 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane?
The canonical SMILES for 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane is CC=CC(=CC(=CC)OC(CCCC)CCCC)OC(CCC)CCSC.
What is the InChIKey of 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane?
The InChIKey is HXLQWRVSWDKGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O2S/c1-7-12-16-23(17-13-8-2)25-21(11-5)20-24(15-10-4)26-22(14-9-3)18-19-27-6/h10-11,15,20,22-23H,7-9,12-14,16-19H2,1-6H3.
What are the key properties of 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane?
5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane has a molecular weight of 396.68 g/mol, XLogP of 8.05, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(1-methylsulfanylhexan-3-yloxy)octa-2,4,6-trien-3-yloxy]nonane is sourced from PubChem (CID 123384884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).