C15H27FO2 — CID 123384982
4-(7-fluoro-2,5-dimethylhept-1-en-3-yl)-2,5-dimethyl-1,3-dioxane (PubChem CID 123384982) has the molecular formula C15H27FO2 and a molecular weight of 258.38 g/mol. Its IUPAC name is 4-(7-fluoro-2,5-dimethylhept-1-en-3-yl)-2,5-dimethyl-1,3-dioxane.
| Compound Name | 4-(7-fluoro-2,5-dimethylhept-1-en-3-yl)-2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 123384982 |
| Molecular Formula | C15H27FO2 |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4-(7-fluoro-2,5-dimethylhept-1-en-3-yl)-2,5-dimethyl-1,3-dioxane |
| SMILES | C=C(C)C(CC(C)CCF)C1OC(C)OCC1C |
| InChI | InChI=1S/C15H27FO2/c1-10(2)14(8-11(3)6-7-16)15-12(4)9-17-13(5)18-15/h11-15H,1,6-9H2,2-5H3 |
| InChIKey | ZZMAKOZFLJNEAE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|