C27H29F3N4 — CID 123385381
8,9,9-triethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 123385381) has the molecular formula C27H29F3N4 and a molecular weight of 466.55 g/mol. Its IUPAC name is 8,9,9-triethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 8,9,9-triethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 123385381 |
| Molecular Formula | C27H29F3N4 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 8,9,9-triethyl-11-(2-methylphenyl)-14-(trifluoromethyl)-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | CCC1c2ccccc2N2c3ncc(C(F)(F)F)nc3N(c3ccccc3C)C2C1(CC)CC |
| InChI | InChI=1S/C27H29F3N4/c1-5-19-18-13-9-11-15-21(18)34-23-24(32-22(16-31-23)27(28,29)30)33(20-14-10-8-12-17(20)4)25(34)26(19,6-2)7-3/h8-16,19,25H,5-7H2,1-4H3 |
| InChIKey | ZGTVOCUMUGJCKU-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |