C7H10F9N3O6S3 — CID 123385688
1,1,2,2,3,3-hexafluoro-N-[2-(methylamino)ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide (PubChem CID 123385688) has the molecular formula C7H10F9N3O6S3 and a molecular weight of 499.36 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-[2-(methylamino)ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-[2-(methylamino)ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
|---|---|
| PubChem CID | 123385688 |
| Molecular Formula | C7H10F9N3O6S3 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.96 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-[2-(methylamino)ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
| SMILES | CNCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F9N3O6S3/c1-17-2-3-18-26(20,21)5(10,11)4(8,9)6(12,13)27(22,23)19-28(24,25)7(14,15)16/h17-19H,2-3H2,1H3 |
| InChIKey | WOWNTXUHZHFHAD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|