C33H61F2N8O2+ — CID 123385905
3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-[4-(1-ethylpyrrolidine-2-carbonyl)piperazin-1-yl]-5-fluoropiperidin-3-yl]propanamide (PubChem CID 123385905) has the molecular formula C33H61F2N8O2+ and a molecular weight of 639.90 g/mol. Its IUPAC name is 3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-[4-(1-ethylpyrrolidine-2-carbonyl)piperazin-1-yl]-5-fluoropiperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-[4-(1-ethylpyrrolidine-2-carbonyl)piperazin-1-yl]-5-fluoropiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123385905 |
| Molecular Formula | C33H61F2N8O2+ |
| Molecular Weight | 639.90 g/mol |
| Exact Mass | 639.49 |
| IUPAC Name | 3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6,7,8-hexahydroazonin-1-ium-2-yl)-N-[4-[4-(1-ethylpyrrolidine-2-carbonyl)piperazin-1-yl]-5-fluoropiperidin-3-yl]propanamide |
| SMILES | CCCC1(CC)CCCC(F)/C=[N+](/C)C(C(C(=O)NC2CNCC(F)C2N2CCN(C(=O)C3CCCN3CC)CC2)C(N)N)C1 |
| InChI | InChI=1S/C33H60F2N8O2/c1-5-12-33(6-2)13-8-10-23(34)22-40(4)27(19-33)28(30(36)37)31(44)39-25-21-38-20-24(35)29(25)42-15-17-43(18-16-42)32(45)26-11-9-14-41(26)7-3/h22-30,38H,5-21,36-37H2,1-4H3/p+1/b40-22- |
| InChIKey | ARLHJLQIYRGTCZ-BOABNOFISA-O |
| XLogP | 1.46 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.90 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|