C9H21N2O6P — CID 123385919
[1-(hydroxyamino)oxy-2,2,6,6-tetramethylpiperidin-4-yl] dihydrogen phosphate (PubChem CID 123385919) has the molecular formula C9H21N2O6P and a molecular weight of 284.25 g/mol. Its IUPAC name is [1-(hydroxyamino)oxy-2,2,6,6-tetramethylpiperidin-4-yl] dihydrogen phosphate.
| Compound Name | [1-(hydroxyamino)oxy-2,2,6,6-tetramethylpiperidin-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 123385919 |
| Molecular Formula | C9H21N2O6P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | [1-(hydroxyamino)oxy-2,2,6,6-tetramethylpiperidin-4-yl] dihydrogen phosphate |
| SMILES | CC1(C)CC(OP(=O)(O)O)CC(C)(C)N1ONO |
| InChI | InChI=1S/C9H21N2O6P/c1-8(2)5-7(16-18(13,14)15)6-9(3,4)11(8)17-10-12/h7,10,12H,5-6H2,1-4H3,(H2,13,14,15) |
| InChIKey | DFGZKBFMRNYJOB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|