C28H28F3N7O2 — CID 123386232
6-[8-amino-1-[4-[hydroxy-[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 123386232) has the molecular formula C28H28F3N7O2 and a molecular weight of 551.57 g/mol. Its IUPAC name is 6-[8-amino-1-[4-[hydroxy-[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | 6-[8-amino-1-[4-[hydroxy-[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 123386232 |
| Molecular Formula | C28H28F3N7O2 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 6-[8-amino-1-[4-[hydroxy-[[4-(trifluoromethyl)-2-pyridinyl]amino]methyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1-methyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC1CC(=O)N2CC(c3nc(-c4ccc(C(O)Nc5cc(C(F)(F)F)ccn5)cc4)c4c(N)nccn34)CCC12 |
| InChI | InChI=1S/C28H28F3N7O2/c1-15-12-22(39)38-14-18(6-7-20(15)38)26-36-23(24-25(32)34-10-11-37(24)26)16-2-4-17(5-3-16)27(40)35-21-13-19(8-9-33-21)28(29,30)31/h2-5,8-11,13,15,18,20,27,40H,6-7,12,14H2,1H3,(H2,32,34)(H,33,35) |
| InChIKey | KENUOPCZTFEFAW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|