C26H25F2N5O5S2 — CID 123386334
(2S)-2-[[3-fluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-isocyano-2-pyridinyl]amino]-3,3-dimethylbutane-1-sulfonic acid (PubChem CID 123386334) has the molecular formula C26H25F2N5O5S2 and a molecular weight of 589.65 g/mol. Its IUPAC name is (2S)-2-[[3-fluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-isocyano-2-pyridinyl]amino]-3,3-dimethylbutane-1-sulfonic acid.
| Compound Name | (2S)-2-[[3-fluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-isocyano-2-pyridinyl]amino]-3,3-dimethylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 123386334 |
| Molecular Formula | C26H25F2N5O5S2 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | (2S)-2-[[3-fluoro-6-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-isocyano-2-pyridinyl]amino]-3,3-dimethylbutane-1-sulfonic acid |
| SMILES | [C-]#[N+]c1cc(F)c(N[C@H](CS(=O)(=O)O)C(C)(C)C)nc1-c1cn(S(=O)(=O)c2ccc(C)cc2)c2ncc(F)cc12 |
| InChI | InChI=1S/C26H25F2N5O5S2/c1-15-6-8-17(9-7-15)40(37,38)33-13-19(18-10-16(27)12-30-25(18)33)23-21(29-5)11-20(28)24(32-23)31-22(26(2,3)4)14-39(34,35)36/h6-13,22H,14H2,1-4H3,(H,31,32)(H,34,35,36)/t22-/m1/s1 |
| InChIKey | CGMLAPMDQYLQQB-JOCHJYFZSA-N |
| XLogP | 5.19 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|