C8H16N2S — CID 123386358
2-sulfanyl-2,8-diazaspiro[4.5]decane (PubChem CID 123386358) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is 2-sulfanyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-sulfanyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 123386358 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-sulfanyl-2,8-diazaspiro[4.5]decane |
| SMILES | SN1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C8H16N2S/c11-10-6-3-8(7-10)1-4-9-5-2-8/h9,11H,1-7H2 |
| InChIKey | BMAQEOGLTMUKEY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|