About (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine
(6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine (PubChem CID 123386515) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine.
Molecular Properties
| Compound Name | (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine |
| PubChem CID | 123386515 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine |
| SMILES | CC1CC=CC=C1OCN |
| InChI | InChI=1S/C8H13NO/c1-7-4-2-3-5-8(7)10-6-9/h2-3,5,7H,4,6,9H2,1H3 |
| InChIKey | QARONWFIZDRUOL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine?
The IUPAC name of (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine (CID 123386515) is (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine.
What is the SMILES notation for (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine?
The canonical SMILES for (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine is CC1CC=CC=C1OCN.
What is the InChIKey of (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine?
The InChIKey is QARONWFIZDRUOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-7-4-2-3-5-8(7)10-6-9/h2-3,5,7H,4,6,9H2,1H3.
What are the key properties of (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine?
(6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine has a molecular weight of 139.20 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylcyclohexa-1,3-dien-1-yl)oxymethanamine is sourced from PubChem (CID 123386515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).