About 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide
2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide (PubChem CID 123386637) has the molecular formula C15H24F2N2O
and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide.
Molecular Properties
| Compound Name | 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide |
| PubChem CID | 123386637 |
| Molecular Formula | C15H24F2N2O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide |
| SMILES | CCCCC(CC(F)(F)CCC)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C15H24F2N2O/c1-3-5-6-12(10-15(16,17)7-4-2)13(20)19-14(11-18)8-9-14/h12H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | BOVAKGNZONWTEN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide?
The IUPAC name of 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide (CID 123386637) is 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide.
What is the SMILES notation for 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide?
The canonical SMILES for 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide is CCCCC(CC(F)(F)CCC)C(=O)NC1(C#N)CC1.
What is the InChIKey of 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide?
The InChIKey is BOVAKGNZONWTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F2N2O/c1-3-5-6-12(10-15(16,17)7-4-2)13(20)19-14(11-18)8-9-14/h12H,3-10H2,1-2H3,(H,19,20).
What are the key properties of 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide?
2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide has a molecular weight of 286.37 g/mol, XLogP of 3.79, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-N-(1-cyanocyclopropyl)-4,4-difluoroheptanamide is sourced from PubChem (CID 123386637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).