C16H22ClN3O2 — CID 123386975
6-chloro-3,7-diethyl-4-(oxolan-3-yl)-3,8-dihydro-1H-pyrazino[2,3-b]azepin-2-one (PubChem CID 123386975) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 6-chloro-3,7-diethyl-4-(oxolan-3-yl)-3,8-dihydro-1H-pyrazino[2,3-b]azepin-2-one.
| Compound Name | 6-chloro-3,7-diethyl-4-(oxolan-3-yl)-3,8-dihydro-1H-pyrazino[2,3-b]azepin-2-one |
|---|---|
| PubChem CID | 123386975 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 6-chloro-3,7-diethyl-4-(oxolan-3-yl)-3,8-dihydro-1H-pyrazino[2,3-b]azepin-2-one |
| SMILES | CCC1=C(Cl)N=C2C(=CC1)NC(=O)C(CC)N2C1CCOC1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-3-10-5-6-12-15(19-14(10)17)20(11-7-8-22-9-11)13(4-2)16(21)18-12/h6,11,13H,3-5,7-9H2,1-2H3,(H,18,21) |
| InChIKey | SJKCJKZBQLKMIS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|