About 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine
3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine (PubChem CID 123387090) has the molecular formula C12H26N4
and a molecular weight of 226.37 g/mol. Its IUPAC name is 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine.
Molecular Properties
| Compound Name | 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine |
| PubChem CID | 123387090 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine |
| SMILES | CCCC/C=C\C=N\CCC(N)NCNC |
| InChI | InChI=1S/C12H26N4/c1-3-4-5-6-7-9-15-10-8-12(13)16-11-14-2/h6-7,9,12,14,16H,3-5,8,10-11,13H2,1-2H3/b7-6-,15-9+ |
| InChIKey | NSAFKMBEIDBENF-KWMXLAOOSA-N |
| XLogP | 1.25 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine?
The IUPAC name of 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine (CID 123387090) is 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine.
What is the SMILES notation for 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine?
The canonical SMILES for 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine is CCCC/C=C\C=N\CCC(N)NCNC.
What is the InChIKey of 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine?
The InChIKey is NSAFKMBEIDBENF-KWMXLAOOSA-N. The full InChI is InChI=1S/C12H26N4/c1-3-4-5-6-7-9-15-10-8-12(13)16-11-14-2/h6-7,9,12,14,16H,3-5,8,10-11,13H2,1-2H3/b7-6-,15-9+.
What are the key properties of 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine?
3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine has a molecular weight of 226.37 g/mol, XLogP of 1.25, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(Z)-hept-2-enylidene]amino]-1-N'-(methylaminomethyl)propane-1,1-diamine is sourced from PubChem (CID 123387090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).