About 5,6-dimethyl-4,5-dihydroazocine
5,6-dimethyl-4,5-dihydroazocine (PubChem CID 123387731) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 5,6-dimethyl-4,5-dihydroazocine.
Molecular Properties
| Compound Name | 5,6-dimethyl-4,5-dihydroazocine |
| PubChem CID | 123387731 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5,6-dimethyl-4,5-dihydroazocine |
| SMILES | CC1=C/C=N\C=CCC1C |
| InChI | InChI=1S/C9H13N/c1-8-4-3-6-10-7-5-9(8)2/h3,5-8H,4H2,1-2H3/b6-3?,9-5?,10-7- |
| InChIKey | FZWRQQFBTJYKNZ-CCGSTMNSSA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dimethyl-4,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-4,5-dihydroazocine?
The IUPAC name of 5,6-dimethyl-4,5-dihydroazocine (CID 123387731) is 5,6-dimethyl-4,5-dihydroazocine.
What is the SMILES notation for 5,6-dimethyl-4,5-dihydroazocine?
The canonical SMILES for 5,6-dimethyl-4,5-dihydroazocine is CC1=C/C=N\C=CCC1C.
What is the InChIKey of 5,6-dimethyl-4,5-dihydroazocine?
The InChIKey is FZWRQQFBTJYKNZ-CCGSTMNSSA-N. The full InChI is InChI=1S/C9H13N/c1-8-4-3-6-10-7-5-9(8)2/h3,5-8H,4H2,1-2H3/b6-3?,9-5?,10-7-.
What are the key properties of 5,6-dimethyl-4,5-dihydroazocine?
5,6-dimethyl-4,5-dihydroazocine has a molecular weight of 135.21 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-4,5-dihydroazocine is sourced from PubChem (CID 123387731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).