About 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine
1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine (PubChem CID 123388268) has the molecular formula C16H34N3+
and a molecular weight of 268.47 g/mol. Its IUPAC name is 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine |
| PubChem CID | 123388268 |
| Molecular Formula | C16H34N3+ |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.27 |
| IUPAC Name | 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine |
| SMILES | CC[N+]1(C)CCC(C2CCCCN2C)(N(C)C)CC1 |
| InChI | InChI=1S/C16H34N3/c1-6-19(5)13-10-16(11-14-19,17(2)3)15-9-7-8-12-18(15)4/h15H,6-14H2,1-5H3/q+1 |
| InChIKey | AFHASCJNUOSDGA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine?
The IUPAC name of 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine (CID 123388268) is 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine.
What is the SMILES notation for 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine?
The canonical SMILES for 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine is CC[N+]1(C)CCC(C2CCCCN2C)(N(C)C)CC1.
What is the InChIKey of 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine?
The InChIKey is AFHASCJNUOSDGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N3/c1-6-19(5)13-10-16(11-14-19,17(2)3)15-9-7-8-12-18(15)4/h15H,6-14H2,1-5H3/q+1.
What are the key properties of 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine?
1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine has a molecular weight of 268.47 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,N,1-trimethyl-4-(1-methylpiperidin-2-yl)piperidin-1-ium-4-amine is sourced from PubChem (CID 123388268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).