About 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine
1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine (PubChem CID 123388373) has the molecular formula C13H20FNO
and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine.
Molecular Properties
| Compound Name | 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine |
| PubChem CID | 123388373 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine |
| SMILES | COC(C=CC=CF)=CCN1CCCCC1 |
| InChI | InChI=1S/C13H20FNO/c1-16-13(7-3-4-9-14)8-12-15-10-5-2-6-11-15/h3-4,7-9H,2,5-6,10-12H2,1H3 |
| InChIKey | IIUDGEZXWWARAA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine?
The IUPAC name of 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine (CID 123388373) is 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine.
What is the SMILES notation for 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine?
The canonical SMILES for 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine is COC(C=CC=CF)=CCN1CCCCC1.
What is the InChIKey of 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine?
The InChIKey is IIUDGEZXWWARAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FNO/c1-16-13(7-3-4-9-14)8-12-15-10-5-2-6-11-15/h3-4,7-9H,2,5-6,10-12H2,1H3.
What are the key properties of 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine?
1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine has a molecular weight of 225.31 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-fluoro-3-methoxyhepta-2,4,6-trienyl)piperidine is sourced from PubChem (CID 123388373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).