C18H35NO13 — CID 123388564
3-[2-(2-carboxyethoxymethyl)-3-(3,3-dihydroxypropoxy)-2-(2,3,4,5-tetrahydroxypentylamino)propoxy]propanoic acid (PubChem CID 123388564) has the molecular formula C18H35NO13 and a molecular weight of 473.47 g/mol. Its IUPAC name is 3-[2-(2-carboxyethoxymethyl)-3-(3,3-dihydroxypropoxy)-2-(2,3,4,5-tetrahydroxypentylamino)propoxy]propanoic acid.
| Compound Name | 3-[2-(2-carboxyethoxymethyl)-3-(3,3-dihydroxypropoxy)-2-(2,3,4,5-tetrahydroxypentylamino)propoxy]propanoic acid |
|---|---|
| PubChem CID | 123388564 |
| Molecular Formula | C18H35NO13 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-[2-(2-carboxyethoxymethyl)-3-(3,3-dihydroxypropoxy)-2-(2,3,4,5-tetrahydroxypentylamino)propoxy]propanoic acid |
| SMILES | O=C(O)CCOCC(COCCC(=O)O)(COCCC(O)O)NCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H35NO13/c20-8-13(22)17(29)12(21)7-19-18(9-30-4-1-14(23)24,10-31-5-2-15(25)26)11-32-6-3-16(27)28/h12-14,17,19-24,29H,1-11H2,(H,25,26)(H,27,28) |
| InChIKey | MAEHVVHINGVCMF-UHFFFAOYSA-N |
| XLogP | -3.91 |
| TPSA | 235.70 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|