About hept-6-ene-2,3-diimine
hept-6-ene-2,3-diimine (PubChem CID 123388790) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is hept-6-ene-2,3-diimine.
Molecular Properties
| Compound Name | hept-6-ene-2,3-diimine |
| PubChem CID | 123388790 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | hept-6-ene-2,3-diimine |
| SMILES | [H]/N=C(C)/C(CCC=C)=N/[H] |
| InChI | InChI=1S/C7H12N2/c1-3-4-5-7(9)6(2)8/h3,8-9H,1,4-5H2,2H3/b8-6+,9-7+ |
| InChIKey | LHDOQIUGXXNHGS-CDJQDVQCSA-N |
| XLogP | 2.01 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-6-ene-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-ene-2,3-diimine?
The IUPAC name of hept-6-ene-2,3-diimine (CID 123388790) is hept-6-ene-2,3-diimine.
What is the SMILES notation for hept-6-ene-2,3-diimine?
The canonical SMILES for hept-6-ene-2,3-diimine is [H]/N=C(C)/C(CCC=C)=N/[H].
What is the InChIKey of hept-6-ene-2,3-diimine?
The InChIKey is LHDOQIUGXXNHGS-CDJQDVQCSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-4-5-7(9)6(2)8/h3,8-9H,1,4-5H2,2H3/b8-6+,9-7+.
What are the key properties of hept-6-ene-2,3-diimine?
hept-6-ene-2,3-diimine has a molecular weight of 124.19 g/mol, XLogP of 2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-ene-2,3-diimine is sourced from PubChem (CID 123388790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).