C17H28N4O5 — CID 123389200
1-[2-[[2-(but-2-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid (PubChem CID 123389200) has the molecular formula C17H28N4O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[2-[[2-(but-2-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid.
| Compound Name | 1-[2-[[2-(but-2-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 123389200 |
| Molecular Formula | C17H28N4O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[2-[[2-(but-2-enoylamino)-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylic acid |
| SMILES | CC=CC(=O)NC(C(=O)NC(C)C(=O)N1CCCC(C(=O)O)N1)C(C)C |
| InChI | InChI=1S/C17H28N4O5/c1-5-7-13(22)19-14(10(2)3)15(23)18-11(4)16(24)21-9-6-8-12(20-21)17(25)26/h5,7,10-12,14,20H,6,8-9H2,1-4H3,(H,18,23)(H,19,22)(H,25,26) |
| InChIKey | HXRDUTHIOKFRIP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|